![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | y2k_sproyt_tu.txt | 2010-07-15 09:56 | 1.8K | |
![[ ]](/icons/unknown.gif) | universitetsavisa_og_forskningsstoff | 2010-07-15 09:56 | 6.9K | |
![[TXT]](/icons/text.gif) | tu_annerledes.txt | 2010-07-15 09:56 | 1.5K | |
![[TXT]](/icons/text.gif) | styremedlemmer_kompetanse_apr05.txt | 2010-07-15 09:56 | 1.1K | |
![[ ]](/icons/unknown.gif) | strategi_for_NTNU | 2010-07-15 09:56 | 2.3K | |
![[ ]](/icons/unknown.gif) | roking | 2010-07-15 09:56 | 3.3K | |
![[ ]](/icons/unknown.gif) | professorforum_apr01.doc | 2010-07-15 09:56 | 24K | |
![[TXT]](/icons/text.gif) | positive_ORGUT_resultat.txt | 2010-07-15 09:56 | 2.3K | |
![[ ]](/icons/unknown.gif) | om-ytringsfrihet-ved-ntnu.docx | 2025-02-25 17:25 | 193K | |
![[ ]](/icons/unknown.gif) | old-ntnu-campussaken-2022.docx | 2022-12-11 19:50 | 21K | |
![[TXT]](/icons/text.gif) | ntnu_et_universitet_adressa2.txt | 2010-07-15 09:56 | 5.0K | |
![[ ]](/icons/unknown.gif) | ntnu_et_universitet_adressa2.doc | 2010-07-15 09:56 | 24K | |
![[TXT]](/icons/text.gif) | ntnu_et_universitet_adressa.txt | 2010-07-15 09:56 | 3.0K | |
![[TXT]](/icons/text.gif) | ntnu-uten-engelske-nettsider-18feb2007.txt | 2010-07-15 09:56 | 670 | |
![[TXT]](/icons/text.gif) | ntnu-fakultet.txt | 2010-07-15 09:56 | 3.2K | |
![[ ]](/icons/unknown.gif) | ntnu-fakultet.doc | 2010-07-15 09:56 | 22K | |
![[ ]](/icons/unknown.gif) | ntnu-campussaken-2023.docx | 2023-01-04 21:25 | 21K | |
![[ ]](/icons/unknown.gif) | ntnu-campussaken-2022-extra.docx | 2022-12-10 08:56 | 22K | |
![[ ]](/icons/unknown.gif) | nth_hegemoni_ud | 2010-07-15 09:56 | 1.7K | |
![[ ]](/icons/unknown.gif) | norsk_skole_des07.doc | 2010-07-15 09:56 | 45K | |
![[TXT]](/icons/text.gif) | materialteknologi-apr2013.txt | 2013-04-03 11:54 | 4.9K | |
![[TXT]](/icons/text.gif) | masteringenior_UA.txt | 2010-07-15 09:56 | 822 | |
![[TXT]](/icons/text.gif) | masteringenior_TU.txt | 2010-07-15 09:56 | 1.5K | |
![[TXT]](/icons/text.gif) | maalform.txt | 2010-07-15 09:56 | 1.9K | |
![[TXT]](/icons/text.gif) | krav-instituttledere-feb2013.txt | 2013-02-22 14:15 | 1.4K | |
![[ ]](/icons/unknown.gif) | kopinor_refusjon_nov03.doc | 2010-07-15 09:56 | 27K | |
![[TXT]](/icons/text.gif) | karakterskala_aug06.txt | 2010-07-15 09:56 | 1.5K | |
![[TXT]](/icons/text.gif) | karakterfordeling.txt | 2011-12-20 09:48 | 1.2K | |
![[DIR]](/icons/folder.gif) | karakterer-2010/ | 2010-07-15 09:56 | - | |
![[TXT]](/icons/text.gif) | gasskraft_ntnudebatt.txt | 2010-07-15 09:56 | 2.2K | |
![[ ]](/icons/unknown.gif) | gasskraft_kommentar | 2010-07-15 09:56 | 1.3K | |
![[ ]](/icons/unknown.gif) | gasskraft_aftenposten.doc | 2010-07-15 09:56 | 24K | |
![[ ]](/icons/unknown.gif) | gasskraft_adressa.doc | 2010-07-15 09:56 | 24K | |
![[TXT]](/icons/text.gif) | gasskraft.txt | 2010-07-15 09:56 | 4.4K | |
![[TXT]](/icons/text.gif) | engelske-websider2(mars08).txt | 2010-07-15 09:56 | 1.0K | |
![[ ]](/icons/layout.gif) | energi-og-miljo-falskt-flagg.pdf | 2025-03-29 15:07 | 110K | |
![[ ]](/icons/unknown.gif) | dring_utvalg_og_Kollegiet | 2010-07-15 09:56 | 6.5K | |
![[ ]](/icons/unknown.gif) | dragvoll-ua-des2022.docx | 2022-12-04 23:19 | 16K | |
![[TXT]](/icons/text.gif) | demotiverende-okonomistryring-sep08.txt | 2010-07-15 09:56 | 2.3K | |
![[ ]](/icons/unknown.gif) | debattinnlegg - Shortcut.lnk | 2023-11-25 22:15 | 1.7K | |
![[TXT]](/icons/text.gif) | campussaken-feb2013.txt | 2013-10-08 10:06 | 413 | |
![[TXT]](/icons/text.gif) | begrav_phd_universitetsavisa_apr03.txt | 2010-07-15 09:56 | 935 | |
![[TXT]](/icons/text.gif) | alle-mastergrader-internasjonale-feb07.txt | 2010-07-15 09:56 | 1.3K | |
![[TXT]](/icons/text.gif) | aa_alle_komiteene.txt | 2010-07-15 09:56 | 1.4K | |
![[ ]](/icons/unknown.gif) | Universitetsliv_USA_Norge.doc | 2010-07-15 09:56 | 31K | |
![[ ]](/icons/unknown.gif) | Skogestad-intervju-UA-juni2013.docx | 2013-06-19 13:15 | 18K | |
![[TXT]](/icons/text.gif) | Reaction conditions - Letter to the Editor CEN Sep 2008.html.folkmigration | 2010-07-15 09:56 | 2.1K | |
![[TXT]](/icons/text.gif) | Reaction conditions - Letter to the Editor CEN Sep 2008.html | 2017-01-31 20:49 | 2.1K | |
![[ ]](/icons/unknown.gif) | På tide å avvikle digital eksamen.docx | 2024-03-11 09:11 | 14K | |
![[TXT]](/icons/text.gif) | Om_vitenskap_UD_feb03.txt | 2010-07-15 09:56 | 1.0K | |
![[ ]](/icons/unknown.gif) | Om_Trond_Andresen | 2010-07-15 09:56 | 1.9K | |
![[TXT]](/icons/text.gif) | ORGUT_adressa_oppfolger.txt | 2010-07-15 09:56 | 1.2K | |
![[TXT]](/icons/text.gif) | ORGUT_adressa.txt | 2010-07-15 09:56 | 5.3K | |
![[ ]](/icons/unknown.gif) | ORGUT_adressa.doc | 2010-07-15 09:56 | 219K | |
![[ ]](/icons/unknown.gif) | NTNU internasjonalt ledende jan2006.eml | 2019-05-09 20:50 | 4.0K | |
![[ ]](/icons/unknown.gif) | Klart-for-Røros-2008.doc | 2010-07-15 09:56 | 26K | |
![[TXT]](/icons/text.gif) | Kjellerdrift_Moholt_nov03.txt | 2010-07-15 09:56 | 703 | |
![[ ]](/icons/unknown.gif) | Hvordan gikk det på Røros 2008.doc | 2010-07-15 09:56 | 28K | |
![[ ]](/icons/unknown.gif) | Er det mer å utforske.docx | 2023-11-25 22:13 | 15K | |
![[ ]](/icons/unknown.gif) | Campusdebatt 2014 UA - Sitatsjekk Skogestad.docx | 2014-03-19 17:20 | 17K | |
![[TXT]](/icons/text.gif) | Bort_med_fakultetene_juni02.txt | 2010-07-15 09:56 | 3.1K | |
![[TXT]](/icons/text.gif) | Bibliotek_plen_universitetsavisa.txt | 2010-07-15 09:56 | 591 | |
![[TXT]](/icons/text.gif) | Adressa-30jun09-Hvordan blir NTNU bedre.txt | 2010-07-15 09:56 | 1.5K | |
![[ ]](/icons/unknown.gif) | 1.kjemi_prosjekt | 2010-07-15 09:56 | 4.3K | |
|