![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/a.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| aiche96-poledir.pdf | 2010-07-15 10:06 | 349K | |
| README.html | 2010-07-15 10:06 | 533 | |
| AIChE96-poledir.ps | 2010-07-15 10:06 | 400K | |
| AIChE96-poledir.info | 2010-07-15 10:06 | 166 | |
Abstract.
This paper considers the design of a stabilizing control structure,
using the information given in the pole directions. It is shown how
the input/output pole directions are related to the minimum input
energy needed to stabilize a given unstable mode.